C10H18AgO — CID 174528917
silver;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 174528917) has the molecular formula C10H18AgO and a molecular weight of 262.12 g/mol. Its IUPAC name is silver;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | silver;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 174528917 |
| Molecular Formula | C10H18AgO |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | silver;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CCC1(C)C(O)C2.[Ag] |
| InChI | InChI=1S/C10H18O.Ag/c1-9(2)7-4-5-10(9,3)8(11)6-7;/h7-8,11H,4-6H2,1-3H3; |
| InChIKey | BWIALOJKEKIBHD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |