C19H28FNO3 — CID 67784339
2-amino-2-fluoro-3-phenylpropanoic acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 67784339) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-amino-2-fluoro-3-phenylpropanoic acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 2-amino-2-fluoro-3-phenylpropanoic acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 67784339 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2-amino-2-fluoro-3-phenylpropanoic acid;(1S,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H](O)C2.NC(F)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H18O.C9H10FNO2/c1-9(2)7-4-5-10(9,3)8(11)6-7;10-9(11,8(12)13)6-7-4-2-1-3-5-7/h7-8,11H,4-6H2,1-3H3;1-5H,6,11H2,(H,12,13)/t7-,8+,10-;/m1./s1 |
| InChIKey | RFJSQPCVPYHYPG-JUHCGIOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|