About 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol
1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 118200054) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol.
Molecular Properties
| Compound Name | 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| PubChem CID | 118200054 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CCC1(NCc1ccccc1)C(O)C2 |
| InChI | InChI=1S/C16H23NO/c1-15(2)13-8-9-16(15,14(18)10-13)17-11-12-6-4-3-5-7-12/h3-7,13-14,17-18H,8-11H2,1-2H3 |
| InChIKey | CEXZWJPSUADCCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol?
The IUPAC name of 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol (CID 118200054) is 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol.
What is the SMILES notation for 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol?
The canonical SMILES for 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol is CC1(C)C2CCC1(NCc1ccccc1)C(O)C2.
What is the InChIKey of 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol?
The InChIKey is CEXZWJPSUADCCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-15(2)13-8-9-16(15,14(18)10-13)17-11-12-6-4-3-5-7-12/h3-7,13-14,17-18H,8-11H2,1-2H3.
What are the key properties of 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol?
1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol has a molecular weight of 245.37 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzylamino)-7,7-dimethylbicyclo[2.2.1]heptan-2-ol is sourced from PubChem (CID 118200054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).