C17H25ClOSe — CID 11057487
[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl-methyl-phenylselanium chloride (PubChem CID 11057487) has the molecular formula C17H25ClOSe and a molecular weight of 359.80 g/mol. Its IUPAC name is [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl-methyl-phenylselanium chloride.
| Compound Name | [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl-methyl-phenylselanium chloride |
|---|---|
| PubChem CID | 11057487 |
| Molecular Formula | C17H25ClOSe |
| Molecular Weight | 359.80 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl-methyl-phenylselanium chloride |
| SMILES | C[Se+](C[C@]12CC[C@H](C[C@H]1O)C2(C)C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C17H25OSe.ClH/c1-16(2)13-9-10-17(16,15(18)11-13)12-19(3)14-7-5-4-6-8-14;/h4-8,13,15,18H,9-12H2,1-3H3;1H/q+1;/p-1/t13-,15-,17-,19?;/m1./s1 |
| InChIKey | PHWSTRYCBUKSAP-GFHKHZIRSA-M |
| XLogP | 0.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.80 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|