C16H21FO2Se — CID 15781236
(1S,2R,4R)-1-[(4-fluorophenyl)seleninylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 15781236) has the molecular formula C16H21FO2Se and a molecular weight of 343.30 g/mol. Its IUPAC name is (1S,2R,4R)-1-[(4-fluorophenyl)seleninylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2R,4R)-1-[(4-fluorophenyl)seleninylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 15781236 |
| Molecular Formula | C16H21FO2Se |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (1S,2R,4R)-1-[(4-fluorophenyl)seleninylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C[Se](=O)c1ccc(F)cc1)[C@H](O)C2 |
| InChI | InChI=1S/C16H21FO2Se/c1-15(2)11-7-8-16(15,14(18)9-11)10-20(19)13-5-3-12(17)4-6-13/h3-6,11,14,18H,7-10H2,1-2H3/t11-,14-,16-,20?/m1/s1 |
| InChIKey | UFHMWJHHSTZPEM-ATBILAKWSA-N |
| XLogP | 2.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|