C21H29O5Se+ — CID 100978582
(1,3-dimethoxy-1,3-dioxopropan-2-yl)-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyl]-phenylselanium (PubChem CID 100978582) has the molecular formula C21H29O5Se+ and a molecular weight of 440.42 g/mol. Its IUPAC name is (1,3-dimethoxy-1,3-dioxopropan-2-yl)-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyl]-phenylselanium.
| Compound Name | (1,3-dimethoxy-1,3-dioxopropan-2-yl)-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyl]-phenylselanium |
|---|---|
| PubChem CID | 100978582 |
| Molecular Formula | C21H29O5Se+ |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (1,3-dimethoxy-1,3-dioxopropan-2-yl)-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyl]-phenylselanium |
| SMILES | COC(=O)C(C(=O)OC)[Se+](CC12CCC(CC1O)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H29O5Se/c1-20(2)14-10-11-21(20,16(22)12-14)13-27(15-8-6-5-7-9-15)17(18(23)25-3)19(24)26-4/h5-9,14,16-17,22H,10-13H2,1-4H3/q+1 |
| InChIKey | YHEOPSLDNQWXRS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|