C19H24O4S — CID 134922385
[(Z)-3-oxo-1-phenylprop-1-enyl] [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfinate (PubChem CID 134922385) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is [(Z)-3-oxo-1-phenylprop-1-enyl] [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfinate.
| Compound Name | [(Z)-3-oxo-1-phenylprop-1-enyl] [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfinate |
|---|---|
| PubChem CID | 134922385 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(Z)-3-oxo-1-phenylprop-1-enyl] [(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfinate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)O/C(=C\C=O)c1ccccc1)[C@H](O)C2 |
| InChI | InChI=1S/C19H24O4S/c1-18(2)15-8-10-19(18,17(21)12-15)13-24(22)23-16(9-11-20)14-6-4-3-5-7-14/h3-7,9,11,15,17,21H,8,10,12-13H2,1-2H3/b16-9-/t15-,17-,19-,24?/m1/s1 |
| InChIKey | QDWPOCSVNLDGPV-CECSCKDCSA-N |
| XLogP | 3.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|