C14H22O5S — CID 23254199
methyl (Z)-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]prop-2-enoate (PubChem CID 23254199) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is methyl (Z)-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]prop-2-enoate |
|---|---|
| PubChem CID | 23254199 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl (Z)-3-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]prop-2-enoate |
| SMILES | COC(=O)/C=C\S(=O)(=O)C[C@]12CC[C@H](C[C@H]1O)C2(C)C |
| InChI | InChI=1S/C14H22O5S/c1-13(2)10-4-6-14(13,11(15)8-10)9-20(17,18)7-5-12(16)19-3/h5,7,10-11,15H,4,6,8-9H2,1-3H3/b7-5-/t10-,11-,14-/m1/s1 |
| InChIKey | WOCVIEMLMBCHKD-CSXRVTFHSA-N |
| XLogP | 1.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|