C17H28O3Te — CID 134881607
methyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]hex-2-enoate (PubChem CID 134881607) has the molecular formula C17H28O3Te and a molecular weight of 408.01 g/mol. Its IUPAC name is methyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]hex-2-enoate.
| Compound Name | methyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]hex-2-enoate |
|---|---|
| PubChem CID | 134881607 |
| Molecular Formula | C17H28O3Te |
| Molecular Weight | 408.01 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]hex-2-enoate |
| SMILES | CCC/C(=C/C(=O)OC)[Te]CC12CCC(CC1O)C2(C)C |
| InChI | InChI=1S/C17H28O3Te/c1-5-6-13(10-15(19)20-4)21-11-17-8-7-12(9-14(17)18)16(17,2)3/h10,12,14,18H,5-9,11H2,1-4H3/b13-10- |
| InChIKey | SOVVZFXXGZBNBK-RAXLEYEMSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.01 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|