C15H24O3Te — CID 134881606
ethyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]prop-2-enoate (PubChem CID 134881606) has the molecular formula C15H24O3Te and a molecular weight of 379.95 g/mol. Its IUPAC name is ethyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]prop-2-enoate |
|---|---|
| PubChem CID | 134881606 |
| Molecular Formula | C15H24O3Te |
| Molecular Weight | 379.95 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | ethyl (Z)-3-[(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methyltellanyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[Te]CC12CCC(CC1O)C2(C)C |
| InChI | InChI=1S/C15H24O3Te/c1-4-18-13(17)6-8-19-10-15-7-5-11(9-12(15)16)14(15,2)3/h6,8,11-12,16H,4-5,7,9-10H2,1-3H3/b8-6- |
| InChIKey | RTMYMTABGZWBFJ-VURMDHGXSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.95 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|