C10H18O4S — CID 174646583
[(1R,2S,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 174646583) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is [(1R,2S,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [(1R,2S,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 174646583 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [(1R,2S,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(C)[C@@H]2CC[C@]1(CS(=O)(=O)O)[C@@H](O)C2 |
| InChI | InChI=1S/C10H18O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7-8,11H,3-6H2,1-2H3,(H,12,13,14)/t7-,8+,10+/m1/s1 |
| InChIKey | UVNMGCYEZKGPLX-WEDXCCLWSA-N |
| XLogP | 1.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|