C12H20O4S — CID 163808522
(4-hydroxy-9,9-dimethyl-5-tricyclo[3.3.1.02,8]nonanyl)methanesulfonic acid (PubChem CID 163808522) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is (4-hydroxy-9,9-dimethyl-5-tricyclo[3.3.1.02,8]nonanyl)methanesulfonic acid.
| Compound Name | (4-hydroxy-9,9-dimethyl-5-tricyclo[3.3.1.02,8]nonanyl)methanesulfonic acid |
|---|---|
| PubChem CID | 163808522 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (4-hydroxy-9,9-dimethyl-5-tricyclo[3.3.1.02,8]nonanyl)methanesulfonic acid |
| SMILES | CC1(C)C2C3CCC1(CS(=O)(=O)O)C(O)CC32 |
| InChI | InChI=1S/C12H20O4S/c1-11(2)10-7-3-4-12(11,6-17(14,15)16)9(13)5-8(7)10/h7-10,13H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | NLFAWNSQGUNDGX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|