C23H37OTe+ — CID 100914427
benzyl-hexyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]tellanium (PubChem CID 100914427) has the molecular formula C23H37OTe+ and a molecular weight of 457.15 g/mol. Its IUPAC name is benzyl-hexyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]tellanium.
| Compound Name | benzyl-hexyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]tellanium |
|---|---|
| PubChem CID | 100914427 |
| Molecular Formula | C23H37OTe+ |
| Molecular Weight | 457.15 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | benzyl-hexyl-[[(1S,2R,4R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methyl]tellanium |
| SMILES | CCCCCC[Te+](Cc1ccccc1)C[C@]12CC[C@H](C[C@H]1O)C2(C)C |
| InChI | InChI=1S/C23H37OTe/c1-4-5-6-10-15-25(17-19-11-8-7-9-12-19)18-23-14-13-20(16-21(23)24)22(23,2)3/h7-9,11-12,20-21,24H,4-6,10,13-18H2,1-3H3/q+1/t20-,21-,23-/m1/s1 |
| InChIKey | SZKWROXYSYTMKO-MQSCRBSSSA-N |
| XLogP | 6.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.15 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|