C15H31IN2 — CID 2750629
[3-(dimethylamino)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-trimethylazanium iodide (PubChem CID 2750629) has the molecular formula C15H31IN2 and a molecular weight of 366.33 g/mol. Its IUPAC name is [3-(dimethylamino)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-trimethylazanium iodide.
| Compound Name | [3-(dimethylamino)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 2750629 |
| Molecular Formula | C15H31IN2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [3-(dimethylamino)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-trimethylazanium iodide |
| SMILES | CN(C)C1C([N+](C)(C)C)C2CCC1(C)C2(C)C.[I-] |
| InChI | InChI=1S/C15H31N2.HI/c1-14(2)11-9-10-15(14,3)13(16(4)5)12(11)17(6,7)8;/h11-13H,9-10H2,1-8H3;1H/q+1;/p-1 |
| InChIKey | BNWIPELUISKJKA-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|