C12H23N — CID 59880501
(2S)-N,N,1,7,7-pentamethylbicyclo[2.2.1]heptan-2-amine (PubChem CID 59880501) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (2S)-N,N,1,7,7-pentamethylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (2S)-N,N,1,7,7-pentamethylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 59880501 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2S)-N,N,1,7,7-pentamethylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CN(C)[C@H]1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C12H23N/c1-11(2)9-6-7-12(11,3)10(8-9)13(4)5/h9-10H,6-8H2,1-5H3/t9?,10-,12?/m0/s1 |
| InChIKey | XUDICDUSDBRTAJ-YZRBJQDESA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |