C28H52N2 — CID 90670992
N,N'-dimethyl-N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine (PubChem CID 90670992) has the molecular formula C28H52N2 and a molecular weight of 416.74 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 90670992 |
| Molecular Formula | C28H52N2 |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 416.41 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine |
| SMILES | CN(CCCCCCN(C)[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C)[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C28H52N2/c1-25(2)21-13-15-27(25,5)23(19-21)29(7)17-11-9-10-12-18-30(8)24-20-22-14-16-28(24,6)26(22,3)4/h21-24H,9-20H2,1-8H3/t21-,22-,23-,24-,27+,28+/m1/s1 |
| InChIKey | SIADIGGRMFNBQP-WUIGYTNCSA-N |
| XLogP | 6.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|