C15H28NO2+ — CID 56843023
(3-acetyloxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-trimethylazanium (PubChem CID 56843023) has the molecular formula C15H28NO2+ and a molecular weight of 254.39 g/mol. Its IUPAC name is (3-acetyloxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-trimethylazanium.
| Compound Name | (3-acetyloxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-trimethylazanium |
|---|---|
| PubChem CID | 56843023 |
| Molecular Formula | C15H28NO2+ |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (3-acetyloxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-trimethylazanium |
| SMILES | CC(=O)OC1C([N+](C)(C)C)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C15H28NO2/c1-10(17)18-13-12(16(5,6)7)11-8-9-15(13,4)14(11,2)3/h11-13H,8-9H2,1-7H3/q+1 |
| InChIKey | JNWZKTOFQIIYHO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|