C17H26O3 — CID 162623230
[(1S,2R,7R,8R,9S)-5-hydroxy-2,6,6,9-tetramethyl-8-tricyclo[5.4.0.02,9]undec-3-enyl] acetate (PubChem CID 162623230) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(1S,2R,7R,8R,9S)-5-hydroxy-2,6,6,9-tetramethyl-8-tricyclo[5.4.0.02,9]undec-3-enyl] acetate.
| Compound Name | [(1S,2R,7R,8R,9S)-5-hydroxy-2,6,6,9-tetramethyl-8-tricyclo[5.4.0.02,9]undec-3-enyl] acetate |
|---|---|
| PubChem CID | 162623230 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1S,2R,7R,8R,9S)-5-hydroxy-2,6,6,9-tetramethyl-8-tricyclo[5.4.0.02,9]undec-3-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@H]3CC[C@@]1(C)[C@]3(C)C=CC(O)C2(C)C |
| InChI | InChI=1S/C17H26O3/c1-10(18)20-14-13-11-6-8-17(14,5)16(11,4)9-7-12(19)15(13,2)3/h7,9,11-14,19H,6,8H2,1-5H3/t11-,12?,13-,14+,16+,17+/m0/s1 |
| InChIKey | RURVEHDQDPGQQP-PJPIWQBGSA-N |
| XLogP | 2.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|