C9H14O3 — CID 11095055
[(1S,4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-yl] acetate (PubChem CID 11095055) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is [(1S,4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11095055 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | [(1S,4R)-4-hydroxy-5,5-dimethylcyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](O)C1(C)C |
| InChI | InChI=1S/C9H14O3/c1-6(10)12-8-5-4-7(11)9(8,2)3/h4-5,7-8,11H,1-3H3/t7-,8+/m1/s1 |
| InChIKey | KWRCXTGFXIDOSH-SFYZADRCSA-N |
| XLogP | 0.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|