C9H14O2 — CID 130145484
2,2-dimethylcyclohepta-4,6-diene-1,3-diol (PubChem CID 130145484) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2,2-dimethylcyclohepta-4,6-diene-1,3-diol.
| Compound Name | 2,2-dimethylcyclohepta-4,6-diene-1,3-diol |
|---|---|
| PubChem CID | 130145484 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2,2-dimethylcyclohepta-4,6-diene-1,3-diol |
| SMILES | CC1(C)C(O)C=CC=CC1O |
| InChI | InChI=1S/C9H14O2/c1-9(2)7(10)5-3-4-6-8(9)11/h3-8,10-11H,1-2H3 |
| InChIKey | POIHAQZHSSRNQU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |