C17H26O5 — CID 163051036
[2a,7-dihydroxy-7a-(hydroxymethyl)-2,2,4a-trimethyl-3,4,7,7b-tetrahydro-1H-cyclobuta[e]inden-3-yl] acetate (PubChem CID 163051036) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [2a,7-dihydroxy-7a-(hydroxymethyl)-2,2,4a-trimethyl-3,4,7,7b-tetrahydro-1H-cyclobuta[e]inden-3-yl] acetate.
| Compound Name | [2a,7-dihydroxy-7a-(hydroxymethyl)-2,2,4a-trimethyl-3,4,7,7b-tetrahydro-1H-cyclobuta[e]inden-3-yl] acetate |
|---|---|
| PubChem CID | 163051036 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2a,7-dihydroxy-7a-(hydroxymethyl)-2,2,4a-trimethyl-3,4,7,7b-tetrahydro-1H-cyclobuta[e]inden-3-yl] acetate |
| SMILES | CC(=O)OC1CC2(C)C=CC(O)C2(CO)C2CC(C)(C)C12O |
| InChI | InChI=1S/C17H26O5/c1-10(19)22-13-8-15(4)6-5-12(20)16(15,9-18)11-7-14(2,3)17(11,13)21/h5-6,11-13,18,20-21H,7-9H2,1-4H3 |
| InChIKey | AWEWWAXAENGDTH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|