C17H24O5 — CID 172883498
[(1S,2S,4R,9R,13R)-13-hydroxy-4,11,11-trimethyl-6-oxo-12-oxatetracyclo[6.3.2.01,9.04,8]tridecan-2-yl] acetate (PubChem CID 172883498) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(1S,2S,4R,9R,13R)-13-hydroxy-4,11,11-trimethyl-6-oxo-12-oxatetracyclo[6.3.2.01,9.04,8]tridecan-2-yl] acetate.
| Compound Name | [(1S,2S,4R,9R,13R)-13-hydroxy-4,11,11-trimethyl-6-oxo-12-oxatetracyclo[6.3.2.01,9.04,8]tridecan-2-yl] acetate |
|---|---|
| PubChem CID | 172883498 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(1S,2S,4R,9R,13R)-13-hydroxy-4,11,11-trimethyl-6-oxo-12-oxatetracyclo[6.3.2.01,9.04,8]tridecan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@]2(C)CC(=O)CC23[C@H](O)O[C@]12[C@@H]3CC2(C)C |
| InChI | InChI=1S/C17H24O5/c1-9(18)21-12-8-15(4)5-10(19)6-16(15)11-7-14(2,3)17(11,12)22-13(16)20/h11-13,20H,5-8H2,1-4H3/t11-,12+,13-,15+,16?,17-/m1/s1 |
| InChIKey | PQLSJUWCPZJJDW-HKDOHRNDSA-N |
| XLogP | 1.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |