C19H30O6 — CID 139203564
[(1S,4R,5R,6R,7R,8S,9R,11S,13S)-9-hydroxy-6,7-dimethoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate (PubChem CID 139203564) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is [(1S,4R,5R,6R,7R,8S,9R,11S,13S)-9-hydroxy-6,7-dimethoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate.
| Compound Name | [(1S,4R,5R,6R,7R,8S,9R,11S,13S)-9-hydroxy-6,7-dimethoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate |
|---|---|
| PubChem CID | 139203564 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | [(1S,4R,5R,6R,7R,8S,9R,11S,13S)-9-hydroxy-6,7-dimethoxy-2,2,9-trimethyl-12-oxatetracyclo[6.3.2.01,4.05,13]tridecan-11-yl] acetate |
| SMILES | CO[C@H]1[C@H](OC)[C@@H]2[C@H]3O[C@@]4([C@@H](OC(C)=O)C[C@@]2(C)O)[C@H](CC4(C)C)[C@@H]13 |
| InChI | InChI=1S/C19H30O6/c1-9(20)24-11-8-18(4,21)13-14-12(15(22-5)16(13)23-6)10-7-17(2,3)19(10,11)25-14/h10-16,21H,7-8H2,1-6H3/t10-,11+,12-,13+,14+,15-,16-,18-,19-/m1/s1 |
| InChIKey | YPKHGAOQVZNYQC-OSWXDGQOSA-N |
| XLogP | 1.53 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |