C23H38O8 — CID 139051644
[(1S,3R,4R,6R,7R,8R,13R,14R,16R)-4,6,14,16-tetrahydroxy-7-methoxy-5,5,9,14-tetramethyl-3-tetracyclo[11.2.1.01,10.04,8]hexadec-9-enyl] acetate;hydrate (PubChem CID 139051644) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is [(1S,3R,4R,6R,7R,8R,13R,14R,16R)-4,6,14,16-tetrahydroxy-7-methoxy-5,5,9,14-tetramethyl-3-tetracyclo[11.2.1.01,10.04,8]hexadec-9-enyl] acetate;hydrate.
| Compound Name | [(1S,3R,4R,6R,7R,8R,13R,14R,16R)-4,6,14,16-tetrahydroxy-7-methoxy-5,5,9,14-tetramethyl-3-tetracyclo[11.2.1.01,10.04,8]hexadec-9-enyl] acetate;hydrate |
|---|---|
| PubChem CID | 139051644 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [(1S,3R,4R,6R,7R,8R,13R,14R,16R)-4,6,14,16-tetrahydroxy-7-methoxy-5,5,9,14-tetramethyl-3-tetracyclo[11.2.1.01,10.04,8]hexadec-9-enyl] acetate;hydrate |
| SMILES | CO[C@@H]1[C@H]2C(C)=C3CC[C@@H]4[C@@H](O)[C@@]3(C[C@@H](OC(C)=O)[C@]2(O)C(C)(C)[C@H]1O)C[C@@]4(C)O.O |
| InChI | InChI=1S/C23H36O7.H2O/c1-11-13-7-8-14-18(25)22(13,10-21(14,5)27)9-15(30-12(2)24)23(28)16(11)17(29-6)19(26)20(23,3)4;/h14-19,25-28H,7-10H2,1-6H3;1H2/t14-,15-,16-,17-,18-,19+,21-,22+,23-;/m1./s1 |
| InChIKey | DBKYZDXPLHRKRU-KOAVFMDTSA-N |
| XLogP | 0.49 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|