C14H20O3 — CID 101267182
[(2R,8aS)-5,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl] acetate (PubChem CID 101267182) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is [(2R,8aS)-5,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,8aS)-5,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 101267182 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [(2R,8aS)-5,8a-dimethyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC2=C(C)C(=O)CC[C@@]2(C)C1 |
| InChI | InChI=1S/C14H20O3/c1-9-12-5-4-11(17-10(2)15)8-14(12,3)7-6-13(9)16/h11H,4-8H2,1-3H3/t11-,14+/m1/s1 |
| InChIKey | NKVZJGFSOMHYFK-RISCZKNCSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |