C15H22O5 — CID 163111550
[(1S,3R,5Z)-3-hydroxy-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate (PubChem CID 163111550) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is [(1S,3R,5Z)-3-hydroxy-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate.
| Compound Name | [(1S,3R,5Z)-3-hydroxy-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate |
|---|---|
| PubChem CID | 163111550 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(1S,3R,5Z)-3-hydroxy-3,4,4,6-tetramethyl-7,8-dioxocyclonon-5-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(=O)C(=O)/C(C)=C\C(C)(C)[C@](C)(O)C1 |
| InChI | InChI=1S/C15H22O5/c1-9-7-14(3,4)15(5,19)8-11(20-10(2)16)6-12(17)13(9)18/h7,11,19H,6,8H2,1-5H3/b9-7-/t11-,15-/m1/s1 |
| InChIKey | NJNSCSVIBSMPIF-ZOZAMDAOSA-N |
| XLogP | 1.57 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|