C14H10O5 — CID 10658838
(4,9-dioxo-2,3-dihydrobenzo[f][1]benzofuran-2-yl) acetate (PubChem CID 10658838) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is (4,9-dioxo-2,3-dihydrobenzo[f][1]benzofuran-2-yl) acetate.
| Compound Name | (4,9-dioxo-2,3-dihydrobenzo[f][1]benzofuran-2-yl) acetate |
|---|---|
| PubChem CID | 10658838 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (4,9-dioxo-2,3-dihydrobenzo[f][1]benzofuran-2-yl) acetate |
| SMILES | CC(=O)OC1CC2=C(O1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H10O5/c1-7(15)18-11-6-10-12(16)8-4-2-3-5-9(8)13(17)14(10)19-11/h2-5,11H,6H2,1H3 |
| InChIKey | LDEYTNHPXUSVGI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|