C17H16O4 — CID 134974296
4a-hydroxy-1,2,3,4,12,12a-hexahydrobenzo[b]xanthene-6,11-dione (PubChem CID 134974296) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4a-hydroxy-1,2,3,4,12,12a-hexahydrobenzo[b]xanthene-6,11-dione.
| Compound Name | 4a-hydroxy-1,2,3,4,12,12a-hexahydrobenzo[b]xanthene-6,11-dione |
|---|---|
| PubChem CID | 134974296 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4a-hydroxy-1,2,3,4,12,12a-hexahydrobenzo[b]xanthene-6,11-dione |
| SMILES | O=C1C2=C(OC3(O)CCCCC3C2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H16O4/c18-14-11-6-1-2-7-12(11)15(19)16-13(14)9-10-5-3-4-8-17(10,20)21-16/h1-2,6-7,10,20H,3-5,8-9H2 |
| InChIKey | ZFDZMDAEPCGQFR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|