C28H24O4 — CID 174898123
1,2,3,4-tetrahydroanthracene-9,10-dione (PubChem CID 174898123) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroanthracene-9,10-dione.
| Compound Name | 1,2,3,4-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 174898123 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1,2,3,4-tetrahydroanthracene-9,10-dione |
| SMILES | O=C1C2=C(CCCC2)C(=O)c2ccccc21.O=C1C2=C(CCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/2C14H12O2/c2*15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h2*1-2,5-6H,3-4,7-8H2 |
| InChIKey | UDBRBPLDWCVSPX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|