C13H10O2S — CID 56615317
3,4-dihydro-1H-benzo[g]isothiochromene-5,10-dione (PubChem CID 56615317) has the molecular formula C13H10O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 3,4-dihydro-1H-benzo[g]isothiochromene-5,10-dione.
| Compound Name | 3,4-dihydro-1H-benzo[g]isothiochromene-5,10-dione |
|---|---|
| PubChem CID | 56615317 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3,4-dihydro-1H-benzo[g]isothiochromene-5,10-dione |
| SMILES | O=C1C2=C(CSCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H10O2S/c14-12-8-3-1-2-4-9(8)13(15)11-7-16-6-5-10(11)12/h1-4H,5-7H2 |
| InChIKey | IYZGOQMSNNAQPQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|