C20H22O2S2 — CID 101212450
16,18-dimethyl-3,13-dithiatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15-pentaene-17,19-dione (PubChem CID 101212450) has the molecular formula C20H22O2S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 16,18-dimethyl-3,13-dithiatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15-pentaene-17,19-dione.
| Compound Name | 16,18-dimethyl-3,13-dithiatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15-pentaene-17,19-dione |
|---|---|
| PubChem CID | 101212450 |
| Molecular Formula | C20H22O2S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 16,18-dimethyl-3,13-dithiatricyclo[13.3.1.16,10]icosa-1(18),6(20),7,9,15-pentaene-17,19-dione |
| SMILES | CC1=C2CSCCc3cccc(c3)CCSCC(=C(C)C1=O)C2=O |
| InChI | InChI=1S/C20H22O2S2/c1-13-17-11-23-8-6-15-4-3-5-16(10-15)7-9-24-12-18(20(17)22)14(2)19(13)21/h3-5,10H,6-9,11-12H2,1-2H3 |
| InChIKey | BXLYNSSDVNLHOD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|