C11H12O2S — CID 82886840
9-methoxy-3,4-dihydro-1H-2-benzothiepin-5-one (PubChem CID 82886840) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 9-methoxy-3,4-dihydro-1H-2-benzothiepin-5-one.
| Compound Name | 9-methoxy-3,4-dihydro-1H-2-benzothiepin-5-one |
|---|---|
| PubChem CID | 82886840 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 9-methoxy-3,4-dihydro-1H-2-benzothiepin-5-one |
| SMILES | COc1cccc2c1CSCCC2=O |
| InChI | InChI=1S/C11H12O2S/c1-13-11-4-2-3-8-9(11)7-14-6-5-10(8)12/h2-4H,5-7H2,1H3 |
| InChIKey | VTCNPONBADJZPK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |