C10H9BrO2 — CID 82024143
2-bromo-4-methoxy-2,3-dihydroinden-1-one (PubChem CID 82024143) has the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. Its IUPAC name is 2-bromo-4-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 2-bromo-4-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 82024143 |
| Molecular Formula | C10H9BrO2 |
| Molecular Weight | 241.08 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 2-bromo-4-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cccc2c1CC(Br)C2=O |
| InChI | InChI=1S/C10H9BrO2/c1-13-9-4-2-3-6-7(9)5-8(11)10(6)12/h2-4,8H,5H2,1H3 |
| InChIKey | CTAUMDWPIGQQQJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.08 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|