C15H11F9O2 — CID 175226392
5-methoxy-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 175226392) has the molecular formula C15H11F9O2 and a molecular weight of 394.23 g/mol. Its IUPAC name is 5-methoxy-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-methoxy-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 175226392 |
| Molecular Formula | C15H11F9O2 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 5-methoxy-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COc1cccc2c1CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2=O |
| InChI | InChI=1S/C15H11F9O2/c1-26-10-4-2-3-8-7(10)5-6-9(11(8)25)12(16,17)13(18,19)14(20,21)15(22,23)24/h2-4,9H,5-6H2,1H3 |
| InChIKey | BASIYNWDNYFPOU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|