About 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole
4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole (PubChem CID 142856128) has the molecular formula C22H23NO4
and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole |
| PubChem CID | 142856128 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole |
| SMILES | COCCc1coc(-c2ccccc2)n1.COc1cccc2c1CCC2=O |
| InChI | InChI=1S/C12H13NO2.C10H10O2/c1-14-8-7-11-9-15-12(13-11)10-5-3-2-4-6-10;1-12-10-4-2-3-7-8(10)5-6-9(7)11/h2-6,9H,7-8H2,1H3;2-4H,5-6H2,1H3 |
| InChIKey | YXTSQFUVOQMCNL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole?
The IUPAC name of 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole (CID 142856128) is 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole.
What is the SMILES notation for 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole?
The canonical SMILES for 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole is COCCc1coc(-c2ccccc2)n1.COc1cccc2c1CCC2=O.
What is the InChIKey of 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole?
The InChIKey is YXTSQFUVOQMCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2.C10H10O2/c1-14-8-7-11-9-15-12(13-11)10-5-3-2-4-6-10;1-12-10-4-2-3-7-8(10)5-6-9(7)11/h2-6,9H,7-8H2,1H3;2-4H,5-6H2,1H3.
What are the key properties of 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole?
4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole has a molecular weight of 365.43 g/mol, XLogP of 4.35, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dihydroinden-1-one;4-(2-methoxyethyl)-2-phenyl-1,3-oxazole is sourced from PubChem (CID 142856128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).