C24H27N4O3+ — CID 54062084
4-butyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1H-1,2,4-triazol-4-ium-5-one (PubChem CID 54062084) has the molecular formula C24H27N4O3+ and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-butyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1H-1,2,4-triazol-4-ium-5-one.
| Compound Name | 4-butyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1H-1,2,4-triazol-4-ium-5-one |
|---|---|
| PubChem CID | 54062084 |
| Molecular Formula | C24H27N4O3+ |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-butyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1H-1,2,4-triazol-4-ium-5-one |
| SMILES | CCCC[N+]1(Cc2ccccc2OCCc2coc(-c3ccccc3)n2)C=NNC1=O |
| InChI | InChI=1S/C24H26N4O3/c1-2-3-14-28(18-25-27-24(28)29)16-20-11-7-8-12-22(20)30-15-13-21-17-31-23(26-21)19-9-5-4-6-10-19/h4-12,17-18H,2-3,13-16H2,1H3/p+1 |
| InChIKey | YINAQSQLYTUURD-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|