C23H25N4O3+ — CID 54253895
4-ethyl-2-methyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1,2,4-triazol-4-ium-3-one (PubChem CID 54253895) has the molecular formula C23H25N4O3+ and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-ethyl-2-methyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1,2,4-triazol-4-ium-3-one.
| Compound Name | 4-ethyl-2-methyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1,2,4-triazol-4-ium-3-one |
|---|---|
| PubChem CID | 54253895 |
| Molecular Formula | C23H25N4O3+ |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-ethyl-2-methyl-4-[[2-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1,2,4-triazol-4-ium-3-one |
| SMILES | CC[N+]1(Cc2ccccc2OCCc2coc(-c3ccccc3)n2)C=NN(C)C1=O |
| InChI | InChI=1S/C23H25N4O3/c1-3-27(17-24-26(2)23(27)28)15-19-11-7-8-12-21(19)29-14-13-20-16-30-22(25-20)18-9-5-4-6-10-18/h4-12,16-17H,3,13-15H2,1-2H3/q+1 |
| InChIKey | PYLWSVYMVITYAU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|