C18H16BrNO2 — CID 18617241
4-[2-[3-(bromomethyl)phenoxy]ethyl]-2-phenyl-1,3-oxazole (PubChem CID 18617241) has the molecular formula C18H16BrNO2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 4-[2-[3-(bromomethyl)phenoxy]ethyl]-2-phenyl-1,3-oxazole.
| Compound Name | 4-[2-[3-(bromomethyl)phenoxy]ethyl]-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 18617241 |
| Molecular Formula | C18H16BrNO2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-[2-[3-(bromomethyl)phenoxy]ethyl]-2-phenyl-1,3-oxazole |
| SMILES | BrCc1cccc(OCCc2coc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C18H16BrNO2/c19-12-14-5-4-8-17(11-14)21-10-9-16-13-22-18(20-16)15-6-2-1-3-7-15/h1-8,11,13H,9-10,12H2 |
| InChIKey | QEERQWPGOXWGPV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|