C23H25N2O4+ — CID 145482250
[(2R)-1-[[3-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carbonyl]oxidanium (PubChem CID 145482250) has the molecular formula C23H25N2O4+ and a molecular weight of 393.46 g/mol. Its IUPAC name is [(2R)-1-[[3-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carbonyl]oxidanium.
| Compound Name | [(2R)-1-[[3-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carbonyl]oxidanium |
|---|---|
| PubChem CID | 145482250 |
| Molecular Formula | C23H25N2O4+ |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [(2R)-1-[[3-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]pyrrolidine-2-carbonyl]oxidanium |
| SMILES | O=C([OH2+])[C@H]1CCCN1Cc1cccc(OCCc2coc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H24N2O4/c26-23(27)21-10-5-12-25(21)15-17-6-4-9-20(14-17)28-13-11-19-16-29-22(24-19)18-7-2-1-3-8-18/h1-4,6-9,14,16,21H,5,10-13,15H2,(H,26,27)/p+1/t21-/m1/s1 |
| InChIKey | HPPVPHJAQKGIGJ-OAQYLSRUSA-O |
| XLogP | 3.18 |
| TPSA | 78.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|