C19H18N2O2S — CID 142046622
[4-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl methanimidothioate (PubChem CID 142046622) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is [4-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl methanimidothioate.
| Compound Name | [4-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl methanimidothioate |
|---|---|
| PubChem CID | 142046622 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [4-[2-(2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl methanimidothioate |
| SMILES | [H]/N=C/SCc1ccc(OCCc2coc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H18N2O2S/c20-14-24-13-15-6-8-18(9-7-15)22-11-10-17-12-23-19(21-17)16-4-2-1-3-5-16/h1-9,12,14,20H,10-11,13H2/b20-14+ |
| InChIKey | MWZHDDNWUMEKKK-XSFVSMFZSA-N |
| XLogP | 4.80 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|