C10H8INO — CID 15726804
4-(iodomethyl)-2-phenyl-1,3-oxazole (PubChem CID 15726804) has the molecular formula C10H8INO and a molecular weight of 285.08 g/mol. Its IUPAC name is 4-(iodomethyl)-2-phenyl-1,3-oxazole.
| Compound Name | 4-(iodomethyl)-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 15726804 |
| Molecular Formula | C10H8INO |
| Molecular Weight | 285.08 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 4-(iodomethyl)-2-phenyl-1,3-oxazole |
| SMILES | ICc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H8INO/c11-6-9-7-13-10(12-9)8-4-2-1-3-5-8/h1-5,7H,6H2 |
| InChIKey | AUXXYEOGNXWTJT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.08 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|