C16H17NO — CID 142811788
4-hept-6-ynyl-2-phenyl-1,3-oxazole (PubChem CID 142811788) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-hept-6-ynyl-2-phenyl-1,3-oxazole.
| Compound Name | 4-hept-6-ynyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 142811788 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-hept-6-ynyl-2-phenyl-1,3-oxazole |
| SMILES | C#CCCCCCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H17NO/c1-2-3-4-5-9-12-15-13-18-16(17-15)14-10-7-6-8-11-14/h1,6-8,10-11,13H,3-5,9,12H2 |
| InChIKey | VOTWZDDYFPQWGS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|