C12H13ClN2O — CID 115084368
3-[2-(3-chlorophenyl)-1,3-oxazol-4-yl]propan-1-amine (PubChem CID 115084368) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)-1,3-oxazol-4-yl]propan-1-amine.
| Compound Name | 3-[2-(3-chlorophenyl)-1,3-oxazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 115084368 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-[2-(3-chlorophenyl)-1,3-oxazol-4-yl]propan-1-amine |
| SMILES | NCCCc1coc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H13ClN2O/c13-10-4-1-3-9(7-10)12-15-11(8-16-12)5-2-6-14/h1,3-4,7-8H,2,5-6,14H2 |
| InChIKey | VAKGFENIBWTOTO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |