C11H12N2O2 — CID 115084355
3-[4-(2-aminoethyl)-1,3-oxazol-2-yl]phenol (PubChem CID 115084355) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-1,3-oxazol-2-yl]phenol.
| Compound Name | 3-[4-(2-aminoethyl)-1,3-oxazol-2-yl]phenol |
|---|---|
| PubChem CID | 115084355 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-[4-(2-aminoethyl)-1,3-oxazol-2-yl]phenol |
| SMILES | NCCc1coc(-c2cccc(O)c2)n1 |
| InChI | InChI=1S/C11H12N2O2/c12-5-4-9-7-15-11(13-9)8-2-1-3-10(14)6-8/h1-3,6-7,14H,4-5,12H2 |
| InChIKey | UAAYTWAUCSOOTO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |