C14H18N2O4 — CID 82489230
2-[2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]ethanamine (PubChem CID 82489230) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]ethanamine.
| Compound Name | 2-[2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 82489230 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-yl]ethanamine |
| SMILES | COc1cc(-c2nc(CCN)co2)cc(OC)c1OC |
| InChI | InChI=1S/C14H18N2O4/c1-17-11-6-9(7-12(18-2)13(11)19-3)14-16-10(4-5-15)8-20-14/h6-8H,4-5,15H2,1-3H3 |
| InChIKey | VATPJOMHHXBLHM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |