C20H21NO5 — CID 18515724
2-[2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-1,3-oxazol-4-yl]ethanol (PubChem CID 18515724) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-1,3-oxazol-4-yl]ethanol.
| Compound Name | 2-[2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-1,3-oxazol-4-yl]ethanol |
|---|---|
| PubChem CID | 18515724 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-1,3-oxazol-4-yl]ethanol |
| SMILES | COc1cc(-c2nc(CCO)co2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H21NO5/c1-23-17-10-15(20-21-16(8-9-22)13-26-20)11-18(24-2)19(17)25-12-14-6-4-3-5-7-14/h3-7,10-11,13,22H,8-9,12H2,1-2H3 |
| InChIKey | RPXRUIYCBBLTMD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |