C24H24N4O4 — CID 160657238
4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole;2-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]ethanamine (PubChem CID 160657238) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole;2-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]ethanamine.
| Compound Name | 4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole;2-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 160657238 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole;2-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]ethanamine |
| SMILES | COc1ccc(-c2nc(CCN)co2)cc1.[C-]#[N+]Cc1coc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C12H10N2O2.C12H14N2O2/c1-13-7-10-8-16-12(14-10)9-3-5-11(15-2)6-4-9;1-15-11-4-2-9(3-5-11)12-14-10(6-7-13)8-16-12/h3-6,8H,7H2,2H3;2-5,8H,6-7,13H2,1H3 |
| InChIKey | RLFBPJSPVFZVJP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|