C23H20ClN3O4 — CID 161103222
4-(chloromethyl)-2-(4-methoxyphenyl)-1,3-oxazole;4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole (PubChem CID 161103222) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(4-methoxyphenyl)-1,3-oxazole;4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-(4-methoxyphenyl)-1,3-oxazole;4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 161103222 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-(chloromethyl)-2-(4-methoxyphenyl)-1,3-oxazole;4-(isocyanomethyl)-2-(4-methoxyphenyl)-1,3-oxazole |
| SMILES | COc1ccc(-c2nc(CCl)co2)cc1.[C-]#[N+]Cc1coc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C12H10N2O2.C11H10ClNO2/c1-13-7-10-8-16-12(14-10)9-3-5-11(15-2)6-4-9;1-14-10-4-2-8(3-5-10)11-13-9(6-12)7-15-11/h3-6,8H,7H2,2H3;2-5,7H,6H2,1H3 |
| InChIKey | UISAGKNPEUETBS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 74.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|