C9H8ClNO2S — CID 81119798
4-(chloromethyl)-2-(3-methoxythiophen-2-yl)-1,3-oxazole (PubChem CID 81119798) has the molecular formula C9H8ClNO2S and a molecular weight of 229.69 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(3-methoxythiophen-2-yl)-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-(3-methoxythiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 81119798 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 4-(chloromethyl)-2-(3-methoxythiophen-2-yl)-1,3-oxazole |
| SMILES | COc1ccsc1-c1nc(CCl)co1 |
| InChI | InChI=1S/C9H8ClNO2S/c1-12-7-2-3-14-8(7)9-11-6(4-10)5-13-9/h2-3,5H,4H2,1H3 |
| InChIKey | DMMJOICPMUHNHE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|