C9H7Cl2NOS — CID 103404233
4-(chloromethyl)-2-(3-chloro-4-methylthiophen-2-yl)-1,3-oxazole (PubChem CID 103404233) has the molecular formula C9H7Cl2NOS and a molecular weight of 248.13 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(3-chloro-4-methylthiophen-2-yl)-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-(3-chloro-4-methylthiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 103404233 |
| Molecular Formula | C9H7Cl2NOS |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 4-(chloromethyl)-2-(3-chloro-4-methylthiophen-2-yl)-1,3-oxazole |
| SMILES | Cc1csc(-c2nc(CCl)co2)c1Cl |
| InChI | InChI=1S/C9H7Cl2NOS/c1-5-4-14-8(7(5)11)9-12-6(2-10)3-13-9/h3-4H,2H2,1H3 |
| InChIKey | XXPACNMUASXJFH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|